Factory supply 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) 772327-44-3 with sufficient stock and high standard

Q: What is the 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI)?

5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is , while it's Molecular Formula is C5H8N2O2. Used in Organic Synthesis: 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is used as a building block in organic synthesis for creating more complex molecules. Its unique structure allows for the formation of various chemical entities, contributing to the development of new compounds with specific properties. Used in Medicinal Chemistry: In the field of medicinal chemistry, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is utilized as a key component in the design and synthesis of pharmaceutical agents. Its presence in molecules can influence their biological activity, making it a valuable asset in drug discovery and development processes. Used in Pharmaceutical Research and Development: 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is of interest in pharmaceutical research and development due to its potential biological activities. Researchers explore its interactions with biological targets to identify new therapeutic opportunities and advance the understanding of its pharmacological profile. Used in Chemical Intermediates for Drug Production: As a chemical intermediate, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) plays a crucial role in the production of various drugs. Its reactivity and structural features enable the synthesis of pharmaceutical compounds with desired therapeutic effects. Used in Biochemical Research: In biochemical research, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) may be employed to study its interactions with enzymes, receptors, or other biomolecules. This research can provide insights into its mechanism of action and potential applications in treating specific diseases or conditions.

Factory supply 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) 772327-44-3 with sufficient stock and high standard We provide high quality 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) (CAS 772327-44-3), at a very affordable prices to our customers.

1.What is the 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) ?

5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is a compound with the molecular formula C6H9NO2, belonging to the oxazolone group of organic compounds. It features a five-membered oxazole ring with an attached aminomethyl group and a methyl group, making it a versatile building block in organic synthesis and medicinal chemistry. 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) holds potential for pharmaceutical research and development due to its possible biological activities.

Used in Organic Synthesis:
5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is used as a building block in organic synthesis for creating more complex molecules. Its unique structure allows for the formation of various chemical entities, contributing to the development of new compounds with specific properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is utilized as a key component in the design and synthesis of pharmaceutical agents. Its presence in molecules can influence their biological activity, making it a valuable asset in drug discovery and development processes.
Used in Pharmaceutical Research and Development:
5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is of interest in pharmaceutical research and development due to its potential biological activities. Researchers explore its interactions with biological targets to identify new therapeutic opportunities and advance the understanding of its pharmacological profile.
Used in Chemical Intermediates for Drug Production:
As a chemical intermediate, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) plays a crucial role in the production of various drugs. Its reactivity and structural features enable the synthesis of pharmaceutical compounds with desired therapeutic effects.
Used in Biochemical Research:
In biochemical research, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) may be employed to study its interactions with enzymes, receptors, or other biomolecules. This research can provide insights into its mechanism of action and potential applications in treating specific diseases or conditions.

2.What is the CAS number for 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) ?

The CAS number of 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is 772327-44-3.

More information of 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) 772327-44-3 are:

CAS?Number	772327-44-3
Density	1.44 g/cm³
Boiling Point	183.7 °C at 760 mmHg
Flash Point	64.9 °C
Vapor Pressure	0.761mmHg at 25°C
Refractive Index	1.593
HS CODE	2934999090
PSA	64.68000
LogP	-0.57520
Pka	7.98±0.29(Predicted)

3.What is the molecular formula of 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) ?

The chemical formula of?5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is C5H8N2O2 which containing 5 Carbon atoms,8 Hydrogen atoms,2 Nitrogen atoms and 2 Oxygen atoms,and the molecular weight, and the molecular weight of 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is 128.13

4.What is 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI)(772327-44-3)used for?

5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is a compound with the molecular formula C6H9NO2, belonging to the oxazolone group of organic compounds. It features a five-membered oxazole ring with an attached aminomethyl group and a methyl group, making it a versatile building block in organic synthesis and medicinal chemistry. 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) holds potential for pharmaceutical research and development due to its possible biological activities.

InChI:InChI=1/C5H8N2O2/c1-3-5(8)9-4(2-6)7-3/h3H,2,6H2,1H3

Relevant articles related to 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI):

5.Factory supply 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) 772327-44-3 with sufficient stock and high standard

Ningbo EST Chemical Co., Ltd is a quality supplier of 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI). Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) 772327-44-3.